For research use only. Not for therapeutic Use.
EDTA Dipotassium Magnesium Salt, Dihydrate is a chelating agent widely used in biochemistry and molecular biology. Known for its ability to bind metal ions, it is essential for stabilizing enzymes and preventing metal-catalyzed oxidation in various biochemical applications. This compound’s high purity ensures consistent and reliable results in experimental procedures. Its applications extend to pharmaceuticals, food preservation, and water treatment, making EDTA Dipotassium Magnesium Salt, Dihydrate a valuable tool in advanced scientific research and industrial processes.
CAS Number | 15708-48-2 |
Molecular Formula | C10H12K2MgN2O8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | magnesium;dipotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
InChI | InChI=1S/C10H16N2O8.2K.Mg/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;/q;2*+1;+2/p-4 |
InChIKey | MUEOBEUHFKBRJH-UHFFFAOYSA-J |
SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Mg+2].[K+].[K+] |