For research use only. Not for therapeutic Use.
(E,E)-4,8,12-Trimethyl-1,3,7,11-tridecatetraene is a naturally occurring hydrocarbon found in various plants. Known for its role in plant signaling and defense, it is used in biochemical research to study plant physiology and pest interactions. This compound’s unique structure makes it valuable in developing agricultural applications, enhancing pest control strategies, and improving crop resilience.
Catalog Number | R024727 |
CAS Number | 62235-06-7 |
Synonyms | (3E,7E)-4,8,12-Trimethyl-1,3,7,11-tridecatetraene; 4,8,12-Trimethyl-1,3E,7E,11-tridecatetraene |
Molecular Formula | C16H26 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
InChI | InChI=1S/C16H26/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h6,9-10,13H,1,7-8,11-12H2,2-5H3/b15-9+,16-13+ |
InChIKey | CWLVBFJCJXHUCF-RNPYNJAESA-N |
SMILES | CC(=CCCC(=CCCC(=CC=C)C)C)C |