For research use only. Not for therapeutic Use.
Eeyarestatin I(Cat No.:I010853)is a small molecule compound known for its role as an inhibitor of the proteasome and an endoplasmic reticulum (ER) stress inducer. It disrupts protein degradation pathways, leading to the accumulation of misfolded proteins and triggering apoptosis in cancer cells. Eeyarestatin I has shown potential in preclinical studies for enhancing the efficacy of cancer therapies by exploiting the stress response in tumor cells. Additionally, it is being investigated for its effects on autophagy and cellular stress responses, providing insights into potential therapeutic strategies for cancer treatment and other diseases.
CAS Number | 412960-54-4 |
Synonyms | 3-(4-Chlorophenyl)-4-[[[(4-chlorophenyl)amino]carbonyl]hydroxyamino]-5,5-dimethyl-2-oxo-1-imidazolidineacetic acid 2-[3-(5-nitro-2-furanyl)-2-propen-1-ylidene]hydrazide |
Molecular Formula | C₂₇H₂₅Cl₂N₇O₇ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble to 100 mM in DMSO |
Storage | Desiccate at +4C |
IUPAC Name | 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[3-(5-nitrofuran-2-yl)prop-2-enylideneamino]acetamide |
InChI | InChI=1S/C27H25Cl2N7O7/c1-27(2)24(35(40)25(38)31-19-9-5-17(28)6-10-19)34(20-11-7-18(29)8-12-20)26(39)33(27)16-22(37)32-30-15-3-4-21-13-14-23(43-21)36(41)42/h3-15,24,40H,16H2,1-2H3,(H,31,38)(H,32,37) |
InChIKey | JTUXTPWYZXWOIB-UHFFFAOYSA-N |
SMILES | CC1(C(N(C(=O)N1CC(=O)NN=CC=CC2=CC=C(O2)[N+](=O)[O-])C3=CC=C(C=C3)Cl)N(C(=O)NC4=CC=C(C=C4)Cl)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |