For research use only. Not for therapeutic Use.
Efavirenz(CAT: A000012) is a non-nucleoside reverse transcriptase inhibitor (NNRTI) widely used as part of antiretroviral therapy for the treatment of HIV-1 infection. By binding to the reverse transcriptase enzyme, Efavirenz prevents the transcription of viral RNA into DNA, inhibiting viral replication. It is typically used in combination with other antiretroviral agents to improve efficacy and reduce resistance development. Efavirenz is known for its effectiveness in reducing viral load and increasing CD4 cell counts. However, it may also cause side effects, including central nervous system symptoms like dizziness and vivid dreams. It remains a key component in many first-line HIV treatment regimens.
| Catalog Number | A000012 |
| CAS Number | 154598-52-4 |
| Synonyms | ustiva, Stocrin, DMP-266, DMP 266 |
| Molecular Formula | C14H9ClF3NO2 |
| Purity | ≥95% |
| Target | HIV |
| Solubility | 15.6mg/mL in DMSO |
| Storage | Store at -20C |
| IUPAC Name | (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChI | InChI=1S/C14H9ClF3NO2/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8/h3-4,7-8H,1-2H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | XPOQHMRABVBWPR-UHFFFAOYSA-N |
| SMILES | ClC1=CC=C2C([C@@](C#CC3CC3)(C(F)(F)F)OC(N2)=O)=C1 |
