For research use only. Not for therapeutic Use.
Effusanin A（Cat No.:R012669）is a natural compound isolated from certain plants, known for its bioactive properties, particularly in the areas of anti-inflammatory and antioxidant activities. It has shown promise in preclinical studies for its potential to modulate immune responses and reduce oxidative stress, which is linked to various chronic diseases, including cancer and cardiovascular disorders. Effusanin A is also being investigated for its potential neuroprotective effects, with research suggesting it could help protect neurons from damage in neurodegenerative diseases. Further studies are needed to fully understand its therapeutic potential and mechanism of action.
| CAS Number | 30220-43-0 |
| Synonyms | (1S,2S,5R,8S,9S,10S,11R,15S)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
| Molecular Formula | C20H28O5 |
| Purity | ≥95% |
| IUPAC Name | (1S,2S,5R,8S,9S,10S,11R,15S)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
| InChI | InChI=1S/C20H28O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h11-14,16,21,23-24H,1,4-9H2,2-3H3/t11-,12+,13+,14-,16+,18-,19+,20-/m1/s1 |
| InChIKey | PXLVZESUZUOWAJ-SLMDOUBJSA-N |
| SMILES | CC1(CC[C@@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H](C4)C(=C)C5=O)(OC3)O)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
