For research use only. Not for therapeutic Use.
Eflornithine hydrochloride (Cat.No:I004566) is a medication primarily used in the treatment of excessive facial hair growth (hirsutism) in women. It works by inhibiting the enzyme ornithine decarboxylase, which is involved in hair follicle growth. Eflornithine hydrochloride helps slow down hair growth, leading to reduced hair density and improved appearance. Consultation with a healthcare professional is advised for proper usage and dosage guidelines.
| Catalog Number | I004566 |
| CAS Number | 68278-23-9 |
| Molecular Formula | C6H13ClF2N2O2 |
| Purity | ≥95% |
| Target | Parasite |
| Solubility | 75 mM in water |
| Storage | Store at -20°C |
| IUPAC Name | 2,5-diamino-2-(difluoromethyl)pentanoic acid;hydrochloride |
| InChI | InChI=1S/C6H12F2N2O2.ClH/c7-4(8)6(10,5(11)12)2-1-3-9;/h4H,1-3,9-10H2,(H,11,12);1H |
| InChIKey | VKDGNNYJFSHYKD-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)F)(C(=O)O)N)CN.Cl |
| Reference | <p style=/line-height:25px/> </p> |
