For research use only. Not for therapeutic Use.
EG1, a specific Pax2 inhibitor, directly binds the paired domain of Pax2 (Kd=1.35-1.5 μM) and inhibits Pax2-DNA interactions. EG1 can inhibit embryonic kidney development, a process directly dependent on Pax2 activity[1].
EG1 (0-12.5 μM; 48 hours) decreases viability in Pax2 positive renal cancer cell lines[1].
EG1 (0-500 μM) is capable of inhibiting Pax2 mediated expression of EGFP without significant effects on Pax2 protein levels[1].
| Catalog Number | I026738 |
| CAS Number | 693241-54-2 |
| Synonyms | 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
| Molecular Formula | C22H18N2O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H18N2O5/c1-29-19-9-5-3-7-17(19)21(26)23-15-12-10-14(11-13-15)20(25)24-18-8-4-2-6-16(18)22(27)28/h2-13H,1H3,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | GYZZRJRJYVMXNS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)NC3=CC=CC=C3C(=O)O |
| Reference | [1]. Grimley E, et al. Inhibition of Pax2 Transcription Activation with a Small Molecule that Targets the DNA Binding Domain. ACS Chem Biol. 2017;12(3):724-734. |
