For research use only. Not for therapeutic Use.
EGFR-IN-69（Cat No.:I043331）is a small molecule inhibitor specifically designed to target and block the epidermal growth factor receptor (EGFR), a protein commonly overexpressed or mutated in various cancers. EGFR plays a pivotal role in regulating cell growth, survival, and proliferation. By inhibiting EGFR activity, EGFR-IN-69 aims to prevent tumor progression and enhance the effectiveness of cancer therapies. This compound shows potential for treating EGFR-driven cancers such as non-small cell lung cancer, colorectal cancer, and head and neck cancers. Ongoing research is focused on evaluating its potency, safety, and clinical applications.
| CAS Number | 2433837-65-9 |
| Synonyms | 5-chloro-N-[5-chloro-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-ethylsulfonylindol-3-yl)pyrimidin-2-amine |
| Molecular Formula | C31H37Cl2N7O3S |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-N-[5-chloro-2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-ethylsulfonylindol-3-yl)pyrimidin-2-amine |
| InChI | InChI=1S/C31H37Cl2N7O3S/c1-4-44(41,42)40-20-23(22-7-5-6-8-27(22)40)30-25(33)19-34-31(36-30)35-26-17-24(32)28(18-29(26)43-3)39-11-9-21(10-12-39)38-15-13-37(2)14-16-38/h5-8,17-21H,4,9-16H2,1-3H3,(H,34,35,36) |
| InChIKey | NEVDBLDTOAJSBN-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1C=C(C2=CC=CC=C21)C3=NC(=NC=C3Cl)NC4=CC(=C(C=C4OC)N5CCC(CC5)N6CCN(CC6)C)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
