For research use only. Not for therapeutic Use.
EHP Inhibitor 2 (Cat No.: I014969) is a small-molecule compound designed to inhibit the activity of Enhancer of Heterochromatin Protein 1 (EHP1), which plays a role in chromatin remodeling and gene expression regulation. By blocking EHP1, this inhibitor can modulate epigenetic signaling pathways involved in cancer progression, inflammation, and neurological disorders. EHP Inhibitor 2 is primarily used in research to study heterochromatin dynamics and gene silencing mechanisms. Its selectivity and efficacy make it a valuable tool for exploring potential epigenetic-based therapeutic strategies.
| CAS Number | 861249-59-4 |
| Molecular Formula | C₁₈H₁₅N₅O |
| Purity | ≥95% |
| Target | Ephrin Receptor |
| IUPAC Name | 6-(3-methoxyphenyl)-3-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| InChI | 1S/C18H15N5O/c1-24-14-6-2-4-12(8-14)15-10-21-18-16(11-22-23(18)17(15)19)13-5-3-7-20-9-13/h2-11H,19H2,1H3 |
| InChIKey | KWGYGRTZRXWSAD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(N3C(=C(C=N3)C4=CN=CC=C4)N=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
