For research use only. Not for therapeutic Use.
EIDD-2749（Cat No.:I042652）is an antiviral compound under investigation for its potential to treat viral infections, particularly those caused by RNA viruses like the flu and coronaviruses. It functions as a viral mutagen, inhibiting the replication of viruses by introducing errors into their RNA genomes, ultimately leading to viral inactivation. EIDD-2749 has shown promise in preclinical studies for its broad-spectrum antiviral activity, including against SARS-CoV-2, the virus responsible for COVID-19. Ongoing clinical trials are evaluating its safety, effectiveness, and potential as a therapeutic option for respiratory viral infections.
| CAS Number | 1613589-24-4 |
| Synonyms | 1-[(2R,3S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| Molecular Formula | C9H11FN2O6 |
| Purity | ≥95% |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChI | InChI=1S/C9H11FN2O6/c10-9(3-13)6(16)5(15)7(18-9)12-2-1-4(14)11-8(12)17/h1-2,5-7,13,15-16H,3H2,(H,11,14,17)/t5-,6+,7-,9-/m1/s1 |
| InChIKey | RDCYLPRXPILMRP-JVZYCSMKSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@](O2)(CO)F)O)O |
