For research use only. Not for therapeutic Use.
eIF4A3-IN-2(Cat No.:I019639) is a small molecule inhibitor that specifically targets eukaryotic initiation factor 4A3 (eIF4A3), an ATP-dependent RNA helicase involved in RNA splicing and translation initiation. By inhibiting eIF4A3, eIF4A3-IN-2 disrupts the formation of the exon junction complex (EJC) and impairs mRNA processing and translation. This inhibition can potentially affect the expression of specific genes and interfere with cellular processes regulated by RNA splicing and translation. However, further research is needed to fully understand the pharmacological activities, applications, and target information of eIF4A3-IN-2, as it is a relatively new compound with ongoing investigations.
Catalog Number | I019639 |
CAS Number | 2095677-20-4 |
Molecular Formula | C₂₅H₁₉Br₂ClN₄O₂ |
Purity | ≥95% |
IUPAC Name | (4-bromophenyl)-[(2S)-4-(6-bromopyrazolo[1,5-a]pyridine-3-carbonyl)-2-(4-chlorophenyl)piperazin-1-yl]methanone |
InChI | InChI=1S/C25H19Br2ClN4O2/c26-18-5-1-17(2-6-18)24(33)31-12-11-30(15-23(31)16-3-8-20(28)9-4-16)25(34)21-13-29-32-14-19(27)7-10-22(21)32/h1-10,13-14,23H,11-12,15H2/t23-/m1/s1 |
InChIKey | WKKAVTNXNVPCCN-HSZRJFAPSA-N |
SMILES | C1CN([C@H](CN1C(=O)C2=C3C=CC(=CN3N=C2)Br)C4=CC=C(C=C4)Cl)C(=O)C5=CC=C(C=C5)Br |
Reference | [1]. Iwatani-Yoshihara M, et al. Discovery and Characterization of a Eukaryotic Initiation Factor 4A-3-Selective Inhibitor That Suppresses Nonsense-Mediated mRNA Decay. ACS Chem Biol. 2017 Jul 21;12(7):1760-1768. |