For research use only. Not for therapeutic Use.
Elacridar (CAT: I001687), also known as GF120918 or GW0918, acts as a potent inhibitor of P-glycoprotein (Pgp), a transporter pivotal in drug efflux. Its versatile utility spans in vitro and in vivo applications, serving as a tool inhibitor to explore transporters’ role in the distribution of diverse test molecules. By suppressing Pgp activity, Elacridar unveils insights into drug interactions, bioavailability, and distribution, contributing to safer pharmaceutical development.
| Catalog Number | I001687 |
| CAS Number | 143664-11-3 |
| Synonyms | GF120918;GG918;GW0918 |
| Molecular Formula | C34H33N3O5 |
| Purity | ≥95% |
| Target | P-glycoprotein |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | N-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-methoxy-9-oxo-10H-acridine-4-carboxamide |
| InChI | 1S/C34H33N3O5/c1-40-28-9-5-7-26-32(28)36-31-25(33(26)38)6-4-8-27(31)34(39)35-24-12-10-21(11-13-24)14-16-37-17-15-22-18-29(41-2)30(42-3)19-23(22)20-37/h4-13,18-19H,14-17,20H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | OSFCMRGOZNQUSW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC3=C(C2=O)C=CC=C3C(=O)NC4=CC=C(C=C4)CCN5CCC6=CC(=C(C=C6C5)OC)OC |
