For research use only. Not for therapeutic Use.
Elastase(Cat No.:I041043)is a serine protease enzyme primarily produced by neutrophils and pancreatic cells. It catalyzes the breakdown of elastin, a key protein in connective tissues that provides elasticity to organs and blood vessels. Elastase plays a critical role in immune response and inflammation, as it is involved in the defense against infections by breaking down bacterial proteins. However, excessive elastase activity can lead to tissue damage, contributing to conditions such as emphysema, cystic fibrosis, and rheumatoid arthritis. It is also studied for its role in various diseases involving connective tissue degradation and remodeling.
CAS Number | 9004-06-2 |
Purity | ≥95% |
IUPAC Name | 4-methylidene-3-prop-2-enylidenecyclohexan-1-ol |
InChI | InChI=1S/2C10H14O/c2*1-3-4-9-7-10(11)6-5-8(9)2/h2*3-4,10-11H,1-2,5-7H2 |
InChIKey | DXPFIOMVMNHFEU-UHFFFAOYSA-N |
SMILES | C=CC=C1CC(CCC1=C)O.C=CC=C1CC(CCC1=C)O |