For research use only. Not for therapeutic Use.
Elenolic Acid is a naturally occurring compound found in olive oil, essential for advanced biochemical and nutraceutical research. This compound plays a crucial role in studying the health benefits of olives, particularly in cardiovascular and anti-inflammatory applications. Its unique properties enable detailed analysis of metabolic pathways and bioactive effects. Elenolic Acid is highly valued for its purity and stability, making it an indispensable tool in developing health-promoting supplements and therapeutic agents, contributing significantly to the advancement of natural medicine and wellness research.
CAS Number | 34422-12-3 |
Synonyms | 3-Formyl-3,4-dihydro-5-(methoxycarbonyl)-2-methyl-2H-Pyran-4-acetic Acid; [2S-(2α,3α,4β)]-3-Formyl-3,4-dihydro-5-(methoxycarbonyl)-2-methyl-2H-Pyran-4-acetic Acid; 5-Carboxy-3-formyl-3,4-dihydro-2-methyl-2H-Pyran-4-acetic Acid 5-Methyl Ester |
Molecular Formula | C11H14O6 |
Purity | ≥95% |
IUPAC Name | 2-[(2S,3S,4S)-3-formyl-5-methoxycarbonyl-2-methyl-3,4-dihydro-2H-pyran-4-yl]acetic acid |
InChI | InChI=1S/C11H14O6/c1-6-8(4-12)7(3-10(13)14)9(5-17-6)11(15)16-2/h4-8H,3H2,1-2H3,(H,13,14)/t6-,7-,8+/m0/s1 |
InChIKey | MQFAJBBHEYTHKF-BIIVOSGPSA-N |
SMILES | CC1C(C(C(=CO1)C(=O)OC)CC(=O)O)C=O |