For research use only. Not for therapeutic Use.
Elesclomol (CAT: I000036) is a small molecule investigational drug with potential anticancer properties. It acts by inducing oxidative stress and selectively targeting cancer cells. Elesclomol promotes the accumulation of reactive oxygen species (ROS) in cancer cells, leading to mitochondrial dysfunction and subsequent apoptosis. This compound has shown efficacy against various types of cancer, including melanoma and ovarian cancer, both as a single agent and in combination with other chemotherapy drugs. Elesclomol’s mechanism of action involves disrupting the balance between ROS production and antioxidant defense systems, ultimately leading to cancer cell death. Clinical trials are ongoing to further evaluate the safety and efficacy of Elesclomol in cancer treatment.
CAS Number | 488832-69-5 |
Synonyms | 1-N’,3-N’-bis(benzenecarbonothioyl)-1-N’,3-N’-dimethylpropanedihydrazide |
Molecular Formula | C19H20N4O2S2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | -20 ℃ |
IUPAC Name | 1-N',3-N'-bis(benzenecarbonothioyl)-1-N',3-N'-dimethylpropanedihydrazide |
InChI | InChI=1S/C19H20N4O2S2/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25) |
InChIKey | BKJIXTWSNXCKJH-UHFFFAOYSA-N |
SMILES | O=C(NN(C)C(C1=CC=CC=C1)=S)CC(NN(C)C(C2=CC=CC=C2)=S)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |