For research use only. Not for therapeutic Use.
Elimusertib-d3 is a high-purity deuterated compound used in advanced pharmaceutical research. This isotopically labeled version of Elimusertib is essential for studies involving kinase inhibitors, pharmacokinetics, and drug metabolism. Featuring three deuterium atoms, it provides precise and reliable analytical results. Its advanced formulation ensures enhanced stability and reproducibility, making it suitable for various experimental setups. Ideal for oncology research and drug development, Elimusertib-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000091 |
| Molecular Formula | C20H18D3N7O |
| Purity | ≥95% |
| Target | PI3K/Akt/mTOR |
| IUPAC Name | (3R)-3-methyl-4-[8-(1H-pyrazol-5-yl)-4-[2-(trideuteriomethyl)pyrazol-3-yl]-1,7-naphthyridin-2-yl]morpholine |
| InChI | InChI=1S/C20H21N7O/c1-13-12-28-10-9-27(13)18-11-15(17-5-8-23-26(17)2)14-3-6-21-20(19(14)24-18)16-4-7-22-25-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,25)/t13-/m1/s1/i2D3 |
| InChIKey | YBXRSCXGRPSTMW-SZIUSNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CC=N1)C2=CC(=NC3=C2C=CN=C3C4=CC=NN4)N5CCOC[C@H]5C |
