For research use only. Not for therapeutic Use.
Eltrombopag-13C4 is a high-purity, carbon-13 labeled derivative of eltrombopag, essential for advanced pharmaceutical and biochemical research. This compound, featuring four carbon-13 atoms, is crucial for studying drug metabolism, pharmacokinetics, and thrombopoietin receptor agonism. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and NMR spectroscopy. Ideal for cutting-edge research in hematology and drug development, Eltrombopag-13C4 enhances the accuracy of experimental data, supporting advancements in therapeutic strategies and drug efficacy studies.
CAS Number | 1217230-31-3 |
Synonyms | 3’-[2-[(2Z)-1-(3,4-Dimethylphenyl)-1,5-dihydro-3-methyl-5-oxo-4H-pyrazol-4-ylidene]hydrazinyl]-2’-hydroxy-[1,1’-biphenyl]-3-carboxylic acid-13C4; SB 497115-13C4 |
Molecular Formula | C25H22N4O4 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 3-[(5E)-5-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]hydrazinylidene]-6-oxocyclohexa-1,3-dien-1-yl]benzoic acid |
InChI | InChI=1S/C25H22N4O4/c1-14-10-11-19(12-15(14)2)29-24(31)22(16(3)28-29)27-26-21-9-5-8-20(23(21)30)17-6-4-7-18(13-17)25(32)33/h4-13,27-28H,1-3H3,(H,32,33)/b26-21+/i3+1,16+1,22+1,24+1 |
InChIKey | TYEXNVNUZXJNBN-MBJCHSFCSA-N |
SMILES | CC1=C(C=C(C=C1)N2C(=O)C(=C(N2)C)NN=C3C=CC=C(C3=O)C4=CC(=CC=C4)C(=O)O)C |