For research use only. Not for therapeutic Use.
Emodin (Cat No.:I003880) is a natural anthraquinone compound found in various plants, such as rhubarb, buckthorn, and Japanese knotweed. It exhibits diverse pharmacological activities, including anti-inflammatory, antioxidant, anticancer, and antimicrobial properties. Emodin has been investigated for its potential therapeutic effects in various diseases, including cancer, cardiovascular disorders, diabetes, and inflammatory conditions. It has been found to inhibit cell proliferation, induce apoptosis, and suppress tumor growth in preclinical studies. Additionally, emodin has shown inhibitory effects on various enzymes and signaling pathways involved in inflammation and oxidative stress.
| Catalog Number | I003880 |
| CAS Number | 518-82-1 |
| Synonyms | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| Molecular Formula | C15H10O5 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | DMSO: ≤ 9.4 mg/mL |
| Storage | 3 years -20C powder |
| Overview of Clinical Research | Emodin is a DNA synthesis inhibitor used for treating cancer. |
| IC50 | observed at 72 hr were as follows: 66.9 uM, Hep3B cells; 74.36 uM, HepG2 cells; and 101.5 uM, Huh7 cells . |
| IUPAC Name | 1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| InChI | InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3 |
| InChIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)O |
| Reference | <br /> |
