For research use only. Not for therapeutic Use.
Emraclidine (CVL-231) is a muscarinic M4 receptor positive allosteric modulator (WO2018002760, compound 11). Emraclidine can be used for the research of neurological diseases[1].
Emraclidine is a muscarinic M4 receptor positive allosteric modulator[1].
| Catalog Number | I026831 |
| CAS Number | 2170722-84-4 |
| Synonyms | 1-(2,4-dimethyl-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-2-[1-[2-(trifluoromethyl)pyridin-4-yl]azetidin-3-yl]ethanone |
| Molecular Formula | C20H21F3N4O |
| Purity | ≥95% |
| InChI | InChI=1S/C20H21F3N4O/c1-12-5-13(2)25-17-11-27(10-16(12)17)19(28)6-14-8-26(9-14)15-3-4-24-18(7-15)20(21,22)23/h3-5,7,14H,6,8-11H2,1-2H3 |
| InChIKey | DTCZNKWBDTXEBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1CN(C2)C(=O)CC3CN(C3)C4=CC(=NC=C4)C(F)(F)F)C |
| Reference | [1]. WO2018002760 |
