Emtricitabine-13C,15N2（Cat No.:R005650） is an isotopically labeled version of emtricitabine, featuring one carbon-13 (13C) and two nitrogen-15 (15N) atoms. This enhancement improves the detection and quantification of the drug in pharmacokinetic and metabolic studies, crucial for HIV treatment research. Emtricitabine is a key component in antiretroviral therapy, and the isotopic labeling allows researchers to track its absorption, distribution, metabolism, and excretion with greater accuracy. Emtricitabine-13C,15N2 is vital for optimizing antiretroviral drug formulations and enhancing the effectiveness of HIV treatment protocols.
| Catalog Number | R005650 |
| CAS Number | 1217820-69-3 |
| Synonyms | 4-Amino-5-fluoro-1-[(2R,5S)-2-hydroxymethyl)-1,3-oxathiolan-5-yl]-2-(1H-pyrimidinone-13C,15N2; (-)-2’,3’-Dideoxy-5-fluoro-3’-thiacytidine-13C,15N2; (-)-2’-Deoxy-5-fluoro-3’-?thiacytidine-13C,15N2; BW 1592-13C,15N2; BW 524W91-13C,15N2; Coviracil-13C,1 |
| Molecular Formula | C8H10FN3O3S |
| Purity | 95% |
| Storage | Store at -20C |
| IUPAC Name | 4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one |
| InChI | InChI=1S/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+/m0/s1/i8+1,11+1,12+1 |
| InChIKey | XQSPYNMVSIKCOC-SJLFXUEQSA-N |
| SMILES | C1[C@H](O[C@H](S1)CO)[15N]2C=C(C(=[15N][13C]2=O)N)F |
