For research use only. Not for therapeutic Use.
EN106（Cat No.:I043743）is a selective small molecule inhibitor that targets specific enzymes involved in the regulation of cellular processes, such as cell proliferation and survival. It is being explored for its potential therapeutic applications in cancer treatment, as it can interfere with pathways essential for tumor growth. By modulating key signaling mechanisms, EN106 may help in overcoming resistance to existing therapies and enhancing the effectiveness of cancer treatments. Preclinical studies suggest that EN106 has promising anti-cancer properties, though further research is necessary to evaluate its safety and efficacy in clinical settings.
| CAS Number | 757192-67-9 |
| Synonyms | 2-chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| Molecular Formula | C13H13ClN2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| InChI | InChI=1S/C13H13ClN2O3/c14-9-13(17)16(5-1-4-15)10-2-3-11-12(8-10)19-7-6-18-11/h2-3,8H,1,5-7,9H2 |
| InChIKey | GLDJSVHDOXCYPT-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)N(CCC#N)C(=O)CCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
