For research use only. Not for therapeutic Use.
EN4 MYC inhibitor (Cat.No:I026835) is a potent and selective MYC inhibitor. It targets the oncogene MYC, which is frequently dysregulated in various cancers. EN4 inhibits MYC’s function, leading to suppression of tumor growth and proliferation. This promising compound holds potential for the development of novel targeted therapies against MYC-driven malignancies.
| Catalog Number | I026835 |
| CAS Number | 1197824-15-9 |
| Synonyms | EN4 MYC inhibitor; EN4; EN-4; EN 4. |
| Molecular Formula | C25H24N2O4 |
| Purity | ≥95% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)phenyl]-4-[(prop-2-enoylamino)methyl]benzamide |
| InChI | InChI=1S/C25H24N2O4/c1-3-24(28)26-17-18-9-11-19(12-10-18)25(29)27-22-7-5-6-8-23(22)31-21-15-13-20(14-16-21)30-4-2/h3,5-16H,1,4,17H2,2H3,(H,26,28)(H,27,29) |
| InChIKey | DKOWGKKELPCHEG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)OC2=CC=CC=C2NC(=O)C3=CC=C(C=C3)CNC(=O)C=C |
| Reference | Boike L, Cioffi AG, Majewski FC, Co J, Henning NJ, Jones MD, Liu G, McKenna JM, Tallarico JA, Schirle M, Nomura DK. Discovery of a Functional Covalent Ligand Targeting an Intrinsically Disordered Cysteine within MYC. Cell Chem Biol. 2021 Jan 21;28(1):4-13.e17. doi: 10.1016/j.chembiol.2020.09.001. Epub 2020 Sep 22. PMID: 32966806; PMCID: PMC7854864. |
