For research use only. Not for therapeutic Use.
EN450 is a cysteine-reactive covalent molecular glue degrader targeting NF-κB. EN450 interacts with allosteric C111 in the E2 ubiquitin ligase UBE2D. EN450 induces the ternary complex formation between UBE2D and NFKB1. EN450 exerts its anti-proliferative effects through a Cullin E3 ligase and proteasome-dependent mechanism[1].
| Catalog Number | I040868 |
| CAS Number | 793719-01-4 |
| Synonyms | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]prop-2-enamide |
| Molecular Formula | C11H13ClN2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H13ClN2O3S/c1-4-11(15)13-10-7-8(5-6-9(10)12)18(16,17)14(2)3/h4-7H,1H2,2-3H3,(H,13,15) |
| InChIKey | OXFXDOLAQBMOPH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)Cl)NC(=O)C=C |
| Reference | [1]. King EA, et al. Chemoproteomics-enabled discovery of a covalent molecular glue degrader targeting NF-κB. Cell Chem Biol. 2023 Apr 20;30(4):394-402.e9. |
