For research use only. Not for therapeutic Use.
EN460(Cat No.:I003743)is a small molecule inhibitor that specifically targets the protein kinase C (PKC) pathway, which plays a crucial role in various cellular processes, including growth, differentiation, and apoptosis. By inhibiting PKC, EN460 has been shown to exhibit potential therapeutic effects in conditions involving abnormal cell signaling, such as cancer, inflammation, and cardiovascular diseases. It has been investigated for its ability to suppress tumor growth and metastasis in preclinical studies. While promising, further research is needed to explore its clinical efficacy, safety, and potential as a therapeutic agent in treating these diseases.
CAS Number | 496807-64-8 |
Molecular Formula | C22H12ClF3N2O4 |
Purity | ≥95% |
Target | ERO1 inhibitor |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 1.9 uM [1] |
IUPAC Name | 2-chloro-5-[(4Z)-5-oxo-4-[(5-phenylfuran-2-yl)methylidene]-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
InChI | InChI=1S/C22H12ClF3N2O4/c23-17-8-6-13(10-15(17)21(30)31)28-20(29)16(19(27-28)22(24,25)26)11-14-7-9-18(32-14)12-4-2-1-3-5-12/h1-11H,(H,30,31)/b16-11- |
InChIKey | RSLFQCNAOMQAIH-WJDWOHSUSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=C(O2)/C=C\3/C(=NN(C3=O)C4=CC(=C(C=C4)Cl)C(=O)O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |