For research use only. Not for therapeutic Use.
Enalapril（Cat No.:I004808）is an angiotensin-converting enzyme (ACE) inhibitor used primarily in the treatment of high blood pressure (hypertension) and heart failure. It works by inhibiting the enzyme ACE, which is responsible for converting angiotensin I to angiotensin II, a potent vasoconstrictor. By reducing angiotensin II levels, enalapril helps relax blood vessels, lower blood pressure, and reduce the heart’s workload. It is also prescribed to prevent kidney damage in patients with diabetes. Enalapril is well-tolerated but can cause side effects like cough, dizziness, or elevated potassium levels in some individuals.
| Catalog Number | I004808 |
| CAS Number | 75847-73-3 |
| Synonyms | N-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline |
| Molecular Formula | C20H28N2O5 |
| Purity | ≥95% |
| Target | Angiotensin-converting Enzyme (ACE) |
| Solubility | DMSO 99 mg/mL; Water <1 mg/mL |
| Storage | -20°C |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C20H28N2O5/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25)/t14-,16-,17-/m0/s1 |
| InChIKey | GBXSMTUPTTWBMN-XIRDDKMYSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O |
| Reference | <p style=/line-height:25px/> </p> |
