For research use only. Not for therapeutic Use.
Enbezotinib(CAT:I040798) is a potent and selective small-molecule inhibitor targeting tropomyosin receptor kinases (TRKs), including TRKA, TRKB, and TRKC. These receptors are involved in neurotrophin signaling pathways that regulate cell survival, proliferation, and differentiation. Enbezotinib is designed to inhibit aberrant TRK fusion proteins, which are implicated in various cancers. By blocking TRK activity, Enbezotinib disrupts oncogenic signaling, demonstrating strong antitumor potential in preclinical and clinical studies. It is being explored as a targeted therapy for solid tumors harboring NTRK gene fusions. Enbezotinib represents a promising therapeutic candidate in precision oncology, particularly for TRK fusion-positive malignancies.
| CAS Number | 2359650-19-2 |
| Synonyms | (3R,7S,17R)-12-fluoro-17-methyl-2,16-dioxa-8,14,19,23,24,26-hexazahexacyclo[22.3.1.03,7.08,27.010,15.021,25]octacosa-1(28),10(15),11,13,21(25),22,26-heptaen-20-one |
| Molecular Formula | C21H21FN6O3 |
| Purity | ≥95% |
| IUPAC Name | (3S,7R,17S)-12-fluoro-17-methyl-2,16-dioxa-8,14,19,23,24,26-hexazahexacyclo[22.3.1.03,7.08,27.010,15.021,25]octacosa-1(28),10(15),11,13,21(25),22,26-heptaen-20-one |
| InChI | InChI=1S/C21H21FN6O3/c1-11-6-23-20(29)14-8-25-28-10-17-19(26-18(14)28)27(15-3-2-4-16(15)31-17)9-12-5-13(22)7-24-21(12)30-11/h5,7-8,10-11,15-16H,2-4,6,9H2,1H3,(H,23,29)/t11-,15+,16-/m1/s1 |
| InChIKey | BYYQDEOVMILBQT-XFBWCDHKSA-N |
| SMILES | CC1CNC(=O)C2=C3N=C4C(=CN3N=C2)OC5CCCC5N4CC6=C(O1)N=CC(=C6)F |
| Reference | [1]. Evan W. ROGERS, et, al. Macrocyclic compounds for treating disease. Patent. WO2019126121 A1. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
