For research use only. Not for therapeutic Use.
Endomorphin-1 Trifluoroacetate(CAT: C000006) is a synthetic, high-affinity μ-opioid receptor (MOR) agonist, structurally designed to mimic endogenous opioid peptides. Its selective binding to MOR modulates pain perception, offering potent analgesic effects with potentially fewer side effects compared to traditional opioids. The trifluoroacetate salt form enhances its stability and solubility for research applications. Endomorphin-1 Trifluoroacetate is widely used in neuroscience and pain management research to study opioid receptor signaling, pain modulation, and the development of novel analgesics with reduced risk of tolerance, dependence, and respiratory depression.
| CAS Number | 329012-86-4 |
| Synonyms | L-Tyrosyl-L-prolyl-L-tryptophyl-L-phenylalaninamide Trifluoroacetate |
| Molecular Formula | C36H39F3N6O7 |
| Purity | ≥95% |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | (2R)-1-[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]-N-[(2R)-1-[[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| InChI | InChI=1S/C34H38N6O5.C2HF3O2/c35-26(17-22-12-14-24(41)15-13-22)34(45)40-16-6-11-30(40)33(44)39-29(19-23-20-37-27-10-5-4-9-25(23)27)32(43)38-28(31(36)42)18-21-7-2-1-3-8-21;3-2(4,5)1(6)7/h1-5,7-10,12-15,20,26,28-30,37,41H,6,11,16-19,35H2,(H2,36,42)(H,38,43)(H,39,44);(H,6,7)/t26-,28-,29-,30-;/m1./s1 |
| InChIKey | HHLSEYUJSLAGOQ-WIRYCGAMSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)[C@@H](CC2=CC=C(C=C2)O)N)C(=O)N[C@H](CC3=CNC4=CC=CC=C43)C(=O)N[C@H](CC5=CC=CC=C5)C(=O)N.C(=O)(C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
