For research use only. Not for therapeutic Use.
Endrin aldehyde(Cat No.:M022957) is a degradation product of the pesticide endrin, which was widely used until concerns about its environmental and health impacts led to widespread bans. Chemically, it arises from the oxidative breakdown of endrin and retains much of its parent compound’s structural elements. Endrin aldehyde is known for its persistence in the environment and potential toxicity, affecting wildlife and human health by accumulating in the food chain. Its presence in ecosystems is a concern due to its ability to cause neurological damage and disrupt endocrine systems in exposed organisms.
CAS Number | 7421-93-4 |
Synonyms | (1alpha,2beta,2abeta,4beta,4abeta,5beta,6abeta,6bbeta,7r*)-ecahydro;1,2,4-methenecyclopenta(c,d)pentalene-r-carboxaldehyde,2,2a,3,3,4,7-hexachloro;1,2,4-methenecyclopenta(c,d)pentalene-r-carboxaldehyde,2,2a,3,3,4,7-hexachlorodecahydro;1,2,4-methenocy |
Molecular Formula | C12H8Cl6O |
Purity | ≥95% |
Documentation | |
Storage | Store at -20 ℃ |
IUPAC Name | 3,4,5,6,6,7-hexachloropentacyclo[6.3.0.02,4.03,7.05,9]undecane-10-carbaldehyde |
InChI | InChI=1S/C12H8Cl6O/c13-8-5-3(2-19)1-4-6(5)9(14,12(8,17)18)11(16)7(4)10(8,11)15/h2-7H,1H2 |
InChIKey | HCTWZIFNBBCVGM-UHFFFAOYSA-N |
SMILES | C1C(C2C3C1C4C5(C2(C(C3(C45Cl)Cl)(Cl)Cl)Cl)Cl)C=O |