For research use only. Not for therapeutic Use.
Enerisant(Cat No.:I006596)is a proprietary compound developed for its potential use as a cognitive enhancer and stimulant. It is designed to improve mental alertness, focus, and overall brain function by modulating neurotransmitter systems, particularly those involved in acetylcholine and dopamine signaling. Enerisant is being explored for its applications in treating cognitive impairments, attention disorders, and fatigue. While the exact mechanism of action is still under investigation, early studies suggest that it may improve memory, concentration, and mental clarity. However, further clinical trials are required to establish its safety, efficacy, and long-term effects.
CAS Number | 1152747-82-4 |
Synonyms | Enerisant;(R)-(1-(4-(3-(2-methylpyrrolidin-1-yl)propoxy)phenyl)-1H-pyrazol-4-yl)(morpholino)methanone |
Molecular Formula | C22H30N4O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4°C for short term or -20 °C for long term |
IC50 | 4.9 nM |
IUPAC Name | [1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazol-4-yl]-morpholin-4-ylmethanone |
InChI | InChI=1S/C22H30N4O3/c1-18-4-2-9-24(18)10-3-13-29-21-7-5-20(6-8-21)26-17-19(16-23-26)22(27)25-11-14-28-15-12-25/h5-8,16-18H,2-4,9-15H2,1H3/t18-/m1/s1 |
InChIKey | IABXVJILZYNSTM-GOSISDBHSA-N |
SMILES | C[C@@H]1CCCN1CCCOC2=CC=C(C=C2)N3C=C(C=N3)C(=O)N4CCOCC4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |