For research use only. Not for therapeutic Use.
Eniluracil is a potent inhibitor of dihydropyrimidine dehydrogenase (DPD), the enzyme responsible for the degradation of fluoropyrimidines like 5-fluorouracil (5-FU). By inhibiting DPD, Eniluracil enhances the bioavailability and therapeutic effectiveness of 5-FU, allowing for lower doses and reducing toxic side effects. This compound is used in cancer research and therapy, particularly in the treatment of solid tumors such as colorectal cancer. Eniluracil’s ability to modulate fluoropyrimidine metabolism makes it a key compound for improving the efficacy of chemotherapeutic regimens and exploring novel cancer treatment strategies.
| Catalog Number | R048140 |
| CAS Number | 59989-18-3 |
| Synonyms | 5-Ethynyl-2,4(1H,3H)-pyrimidinedione; 5-Ethynyluracil; NSC 687296; |
| Molecular Formula | C6H4N2O2 |
| Purity | ≥95% |
| Target | Alkynes |
| Storage | Store at -20°C |
| IUPAC Name | 5-ethynyl-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C6H4N2O2/c1-2-4-3-7-6(10)8-5(4)9/h1,3H,(H2,7,8,9,10) |
| InChIKey | JOZGNYDSEBIJDH-UHFFFAOYSA-N |
| SMILES | C#CC1=CNC(=O)NC1=O |
