For research use only. Not for therapeutic Use.
Enocitabine(Cat No.:R004087)is a prodrug of cytarabine, a nucleoside analog with potent antineoplastic activity. Once metabolized, it converts to cytarabine, which inhibits DNA synthesis by incorporating into DNA and halting cell division. Enocitabine is used primarily in cancer research, particularly in studies focusing on hematological malignancies such as acute myeloid leukemia (AML). Its extended half-life compared to cytarabine allows for prolonged action, making it a valuable compound for investigating sustained therapeutic effects in chemotherapy protocols and the mechanisms of action in cancer cell proliferation.
Catalog Number | R004087 |
CAS Number | 55726-47-1 |
Synonyms | N-(1-B-D-Arabinofuranosyl-1,2-dihydro-2-oxo-4-pyrimidinyl)docosanamide, Behenoylcytosine Arabinoside, BH-AC, NSC-239336, Sunrabin |
Molecular Formula | C31H55N3O6 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | N-[1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]docosanamide |
InChI | InChI=1S/C31H55N3O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(36)32-26-22-23-34(31(39)33-26)30-29(38)28(37)25(24-35)40-30/h22-23,25,28-30,35,37-38H,2-21,24H2,1H3,(H,32,33,36,39)/t25-,28-,29+,30-/m1/s1 |
InChIKey | SAMRUMKYXPVKPA-VFKOLLTISA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)NC1=NC(=O)N(C=C1)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |