For research use only. Not for therapeutic Use.
Enoxacin（Cat No.:A000460）is a broad-spectrum fluoroquinolone antibiotic used to treat various bacterial infections. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes essential for DNA replication and transcription, leading to bacterial cell death. Enoxacin is effective against a wide range of Gram-positive and Gram-negative bacteria, making it useful in treating urinary tract infections, respiratory infections, and sexually transmitted diseases. It is particularly valued for its oral bioavailability and ability to penetrate tissues, making it a critical tool in combating bacterial infections and preventing their spread.
| Catalog Number | A000460 |
| CAS Number | 74011-58-8 |
| Synonyms | 74011-58-8; Penetrex; Enoxacine; Comprecin; Enoxacino |
| Molecular Formula | C15H17FN4O3 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid |
| InChI | InChI=1S/C15H17FN4O3/c1-2-19-8-10(15(22)23)12(21)9-7-11(16)14(18-13(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,22,23) |
| InChIKey | IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(N=C21)N3CCNCC3)F)C(=O)O |
