For research use only. Not for therapeutic Use.
Enrofloxacin is a fluoroquinolone antibiotic commonly used in veterinary medicine. Enrofloxcin is slightly soluble in aqueous solution and enrofloxacin HCl is freely soluble at 10 mg/mL.</br>Fluoroquinolone antibiotics target bacterial DNA gyrase, an enzyme which reduces DNA strain during replication. Because DNA gyrase is required during DNA replication, subsequent DNA synthesis and ultimately cell division is inhibited.
| Catalog Number | M028368 |
| CAS Number | 112732-17-9 |
| Molecular Formula | C19H23ClFN3O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C19H22FN3O3.ClH/c1-2-21-5-7-22(8-6-21)17-10-16-13(9-15(17)20)18(24)14(19(25)26)11-23(16)12-3-4-12;/h9-12H,2-8H2,1H3,(H,25,26);1H |
| InChIKey | PZJWYUDBXNNVLZ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)F.Cl |
| Reference | <p>Wolfson, John S., and David C. Hooper. /The Fluoroquinolones: Structures, Mechanisms of Action and Resistance, and Spectra of Activity in Vitro./ <em>American Society for Microbiology</em> 4th ser. 28 (1985): 581-86.</p></span></p> |
