For research use only. Not for therapeutic Use.
Corey prostaglandin (PG)-<wbr></wbr>lactone diol is a versatile, chiral intermediate used in the preparation of PGs and PG analogs. ent-<wbr></wbr>Corey PG-<wbr></wbr>lactone diol is the opposite enantiomer of corey PG-<wbr></wbr>lactone diol.
| Catalog Number | R048205 |
| CAS Number | 53110-06-8 |
| Synonyms | (6aR)-5S-hydroxy-4S-((R,E)-3aS-hydroxyoct-1-en-1-yl)hexahydro-2H-cyclopenta[b]furan-2-one |
| Molecular Formula | C15H24O4 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C15H24O4/c1-2-3-4-5-10(16)6-7-11-12-8-15(18)19-14(12)9-13(11)17/h6-7,10-14,16-17H,2-5,8-9H2,1H3/b7-6+/t10-,11+,12+,13+,14-/m1/s1 |
| InChIKey | UMDQPEMZJHAFNL-LAJPVCDTSA-N |
| SMILES | O=C1C[C@@H]2[C@@H]([C@H](O)C[C@H]2/C=C/[C@H](O)CCCCC)O1 |
