For research use only. Not for therapeutic Use.
ent-Ezetimibe is a stereoisomer of ezetimibe, a lipid-lowering medication that inhibits the intestinal absorption of cholesterol. This compound works by blocking the Niemann-Pick C1-like 1 (NPC1L1) protein, thereby reducing cholesterol levels in the bloodstream. Its unique enantiomeric configuration may offer insights into the pharmacokinetics and pharmacodynamics of ezetimibe. Research on ent-ezetimibe explores its potential efficacy and safety profiles, contributing to the development of improved cholesterol-lowering therapies and understanding the mechanisms of cholesterol absorption in the body.
| Catalog Number | R054272 |
| CAS Number | 1376614-99-1 |
| Synonyms | (3S,4R)-1-(4-fluorophenyl)-3-[(3R)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| Molecular Formula | C24H21F2NO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m0/s1 |
| InChIKey | OLNTVTPDXPETLC-ZRBLBEILSA-N |
| SMILES | C1=CC(=CC=C1C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(C4=CC=C(C=C4)F)O)O |
