For research use only. Not for therapeutic Use.
Entasobulin is a β-tubulin polymerization inhibitor with potential anticancer activity.
Entasobulin is a indolizine-glyoxylamide based small molecule that demonstrate substantial in vitro anti-proliferative activities against cancer cell lines, including multidrug resistance (MDR) phenotypes.
| Catalog Number | I006679 |
| CAS Number | 501921-61-5 |
| Synonyms | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide |
| Molecular Formula | C26H18ClN3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C26H18ClN3O2/c27-19-9-7-17(8-10-19)15-30-16-22(21-5-1-2-6-24(21)30)25(31)26(32)29-20-11-12-23-18(14-20)4-3-13-28-23/h1-14,16H,15H2,(H,29,32) |
| InChIKey | LJIUXAHLYIPHOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)C(=O)C(=O)NC4=CC5=C(C=C4)N=CC=C5 |
