For research use only. Not for therapeutic Use.
Entinostat-d4(Cat No.:S000449) is a deuterated form of entinostat, where four hydrogen atoms are replaced with deuterium. This modification is used to explore the drug’s pharmacokinetics and metabolic stability more extensively. Entinostat is a potent histone deacetylase (HDAC) inhibitor used in cancer therapy to regulate gene expression by modifying the chromatin structure. It primarily works by promoting acetylation of histone proteins, leading to the activation of tumor suppressor genes and the suppression of tumor growth. The deuterated version, Entinostat-d4, helps researchers investigate how these changes affect the drug’s activity and distribution in the body.
Catalog Number | S000449 |
Molecular Formula | C21H16D4N4O3 |
Purity | ≥95% |
Target | Autophagy |
IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-amino-3,4,5,6-tetradeuteriophenyl)carbamoyl]phenyl]methyl]carbamate |
InChI | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16/h1-12H,13-14,22H2,(H,24,27)(H,25,26)/i1D,2D,5D,6D |
InChIKey | INVTYAOGFAGBOE-NMRLXUNGSA-N |
SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC(=O)OCC3=CN=CC=C3 |