For research use only. Not for therapeutic Use.
Epaminurad（Cat No.:I026910）is an investigational drug designed to target and inhibit the urate transporter 1 (URAT1), a protein responsible for the reabsorption of uric acid in the kidneys. By blocking URAT1, Epaminurad aims to reduce the levels of uric acid in the blood, offering potential therapeutic benefits for conditions like gout and hyperuricemia. Elevated uric acid levels contribute to the formation of urate crystals, causing painful inflammation in joints. Epaminurad is being evaluated in clinical trials to determine its effectiveness and safety in managing these conditions and improving patient outcomes.
| CAS Number | 1198153-15-9 |
| Synonyms | (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone |
| Molecular Formula | C14H10Br2N2O3 |
| Purity | ≥95% |
| IUPAC Name | (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone |
| InChI | InChI=1S/C14H10Br2N2O3/c15-9-5-8(6-10(16)13(9)19)14(20)18-3-4-21-12-1-2-17-7-11(12)18/h1-2,5-7,19H,3-4H2 |
| InChIKey | ZMVGQIIOXCGAFV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1C(=O)C3=CC(=C(C(=C3)Br)O)Br)C=NC=C2 |
