For research use only. Not for therapeutic Use.
Ephedroxane（Cat No.:M077008） is a chemical compound with structural similarities to ephedrine, a naturally occurring alkaloid found in plants like Ephedra sinica. It belongs to the class of phenethylamine derivatives and exhibits stimulant properties, primarily affecting the central nervous system. Ephedroxane is synthesized through chemical modifications of ephedrine, typically involving oxidation or rearrangement reactions. Due to its stimulant effects, it has been investigated for potential use in pharmaceuticals or as a research tool.
| Catalog Number | M077008 |
| CAS Number | 16251-46-0 |
| Molecular Formula | C11H13NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-one |
| InChI | InChI=1S/C11H13NO2/c1-8-10(14-11(13)12(8)2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | MNYARIILPGRTQL-WPRPVWTQSA-N |
| SMILES | CC1C(OC(=O)N1C)C2=CC=CC=C2 |
