For research use only. Not for therapeutic Use.
Epiberberine chloride(CAT: I005331) is a natural isoquinoline alkaloid, typically derived from plants of the Berberidaceae family. It exhibits a range of pharmacological activities, including antioxidant, anti-inflammatory, and antidiabetic properties. Epiberberine chloride has been studied for its ability to modulate lipid metabolism, improve insulin sensitivity, and inhibit enzymes involved in carbohydrate digestion, making it a promising compound for metabolic and cardiovascular disease research. Additionally, it has shown potential in antimicrobial and anticancer studies due to its effects on cellular signaling pathways. Its diverse bioactivities make it a valuable tool for exploring therapeutic mechanisms in various disease contexts.
CAS Number | 889665-86-5 |
Molecular Formula | C20H18ClNO4 |
Purity | ≥95% |
Target | NF-κB |
Solubility | DMSO: < 7.8 mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | 16,17-dimethoxy-5,7-dioxa-1-azoniapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaene;chloride |
InChI | InChI=1S/C20H18NO4.ClH/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1 |
InChIKey | DGRBIBRPLDAHJH-UHFFFAOYSA-M |
SMILES | COC1=C(C=C2C(=C1)CC[N+]3=C2C=C4C=CC5=C(C4=C3)OCO5)OC.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |