For research use only. Not for therapeutic Use.
Epibrassinolide (Cat.No:I004891) is a plant growth regulator belonging to the brassinosteroid group. It plays a crucial role in various physiological processes, including cell elongation, seed germination, and stress tolerance. Epibrassinolide promotes plant growth, enhances crop yield, and increases resistance to environmental stresses, making it a valuable tool in agriculture. It has potential antioxidant effects, helping plants combat oxidative damage. Research into its use as a plant growth regulator continues, with promising applications in agriculture and horticulture.
CAS Number | 78821-43-9 |
Synonyms | 22R,23R,24R-2α,3α,22,23-Tetrahydroxy-B-homo-7-oxa-5α-ergostan-6-one; 24-Epibrassinolide |
Molecular Formula | C28H48O6 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 5 mg/mL |
Storage | Store at -20°C |
IUPAC Name | (1S,2R,4R,5S,7S,11S,12S,15R,16S)-15-[(2S,3R,4R,5R)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
InChI | InChI=1S/C28H48O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14-25,29-32H,7-13H2,1-6H3/t15-,16+,17+,18-,19+,20+,21-,22+,23-,24-,25-,27-,28-/m1/s1 |
InChIKey | IXVMHGVQKLDRKH-QHBHMFGVSA-N |
SMILES | O=C1[C@]2([H])[C@@](C[C@@H](O)[C@@H](O)C2)(C)[C@@]3([H])CC[C@@]4(C)[C@](CC[C@]4([H])[C@H](C)[C@@H](O)[C@H](O)[C@H](C)C(C)C)([H])[C@]3([H])CO1 |
Reference | <p> |