For research use only. Not for therapeutic Use.
Epichlorohydrin-d5 is a deuterated form of epichlorohydrin, featuring five deuterium atoms that enhance its stability and precision for analytical applications. This compound is used primarily in chemical and pharmaceutical research to study reaction mechanisms and metabolic pathways using NMR and mass spectrometry. It serves as an important reagent in the synthesis of epoxy resins and other polymer materials. The deuterium labeling aids in tracking chemical transformations and analyzing the behavior of epichlorohydrin in various reaction environments, contributing to advancements in material science and polymer chemistry.
CAS Number | 69533-54-6 |
Synonyms | 2-(Chloromethyl)oxirane-d5; (Chloromethyl)ethylene-d5 Oxide; (Chloromethyl)oxirane-d5; (RS)-Epichlorhydrin-d5; (+/-)-Epichlorohydrin-d5; 1,2-Epoxy-3-chloropropane-d5; 1-Chloro-2,3-epoxypropane-d5; 2,3-Epoxypropyl Chloride-d5; Glycerol Epichlorohydrin |
Molecular Formula | C3H5ClO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[chloro(dideuterio)methyl]-2,3,3-trideuteriooxirane |
InChI | InChI=1S/C3H5ClO/c4-1-3-2-5-3/h3H,1-2H2/i1D2,2D2,3D |
InChIKey | BRLQWZUYTZBJKN-UXXIZXEISA-N |
SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])Cl)[2H] |