For research use only. Not for therapeutic Use.
Epiprogoitrin（Cat No.:M080660）, is a natural compound found in certain plants, particularly in members of the Brassicaceae family, like broccoli and cabbage. It is classified as a glucosinolate, a group of sulfur-containing organic compounds. Epiprogoitrin, upon enzymatic breakdown, releases goitrin, which can interfere with iodine uptake by the thyroid gland, potentially contributing to goiter formation, a condition characterized by thyroid gland enlargement.
| Catalog Number | M080660 |
| CAS Number | 19237-18-4 |
| Molecular Formula | C11H19NO10S2 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at RT |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E,3S)-3-hydroxy-N-sulfooxypent-4-enimidothioate |
| InChI | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/b12-7+/t5-,6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | MYHSVHWQEVDFQT-QSKOKFRPSA-N |
| SMILES | C=CC(CC(=NOS(=O)(=O)O)SC1C(C(C(C(O1)CO)O)O)O)O |
