For research use only. Not for therapeutic Use.
Epirizole（Cat No.:M082069）is a synthetic compound being investigated for its potential use in treating allergic reactions and inflammatory conditions. It functions as a selective H1 receptor antagonist, meaning it blocks histamine receptors involved in allergic responses, helping to reduce symptoms such as itching, swelling, and redness. Epirizole has shown promise in preclinical studies for its ability to alleviate symptoms of allergies and other histamine-mediated conditions without causing significant sedation, which is a common side effect of many antihistamines. Clinical trials are ongoing to assess its safety, efficacy, and potential as an allergy treatment.
| CAS Number | 18694-40-1 |
| Synonyms | 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine |
| Molecular Formula | C11H14N4O2 |
| Purity | ≥95% |
| IUPAC Name | 4-methoxy-2-(5-methoxy-3-methylpyrazol-1-yl)-6-methylpyrimidine |
| InChI | InChI=1S/C11H14N4O2/c1-7-5-9(16-3)13-11(12-7)15-10(17-4)6-8(2)14-15/h5-6H,1-4H3 |
| InChIKey | RHAXSHUQNIEUEY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2C(=CC(=N2)C)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
