For research use only. Not for therapeutic Use.
Epirubicin Hydrochloride（Cat No.:I004105）is a potent anthracycline antibiotic used primarily as a chemotherapeutic agent in cancer treatment. It works by intercalating into DNA, disrupting the replication of cancer cells and inhibiting topoisomerase II, leading to cell death. Epirubicin is widely used in the treatment of various cancers, including breast cancer, gastric cancer, and lymphomas. Its hydrochloride form enhances its solubility and stability, making it suitable for intravenous administration. Despite its effectiveness, careful monitoring is required due to potential cardiotoxicity and other side effects associated with anthracyclines.
| Catalog Number | I004105 |
| CAS Number | 56390-09-1 |
| Synonyms | (7S,9S)-7-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| Molecular Formula | C₂₇H₂₉NO₁₁ · HCl |
| Purity | ≥95% |
| Target | Topoisomerase |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| InChI | InChI=1S/C27H29NO11.ClH/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34;/h3-5,10,13,15,17,22,29,31,33,35-36H,6-9,28H2,1-2H3;1H/t10-,13-,15-,17-,22-,27-;/m0./s1 |
| InChIKey | MWWSFMDVAYGXBV-FGBSZODSSA-N |
| SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O.Cl |
