For research use only, not for therapeutic use.
Episilvestrol (Cat No.:I004617) is a natural compound derived from the plant Tripterygium wilfordii. It belongs to the class of rocaglate derivatives and exhibits potent anticancer activity. Episilvestrol specifically targets the eukaryotic translation initiation factor 4A (eIF4A), an RNA helicase involved in translation initiation. By inhibiting eIF4A, episilvestrol disrupts protein synthesis and leads to the selective translation inhibition of certain oncogenic mRNAs, including those encoding c-Myc and Mcl-1. This results in the suppression of cell proliferation and induction of apoptosis in cancer cells. Episilvestrol has shown promising preclinical activity against various cancer types, making it a potential candidate for further development as an anticancer therapy.
| Catalog Number | I004617 |
| CAS Number | 697235-39-5 |
| Molecular Formula | C34H38O13 |
| Purity | ≥95% |
| Target | Apoptosis inducer |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-6-[[(2S,3R,6R)-6-[(1R)-1,2-dihydroxyethyl]-3-methoxy-1,4-dioxan-2-yl]oxy]-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| InChI | InChI=1S/C34H38O13/c1-40-20-12-10-19(11-13-20)34-27(18-8-6-5-7-9-18)26(30(38)42-3)29(37)33(34,39)28-23(41-2)14-21(15-24(28)47-34)45-32-31(43-4)44-17-25(46-32)22(36)16-35/h5-15,22,25-27,29,31-32,35-37,39H,16-17H2,1-4H3/t22-,25-,26-,27-,29-,31-,32-,33+,34+/m1/s1 |
| InChIKey | GVKXFVCXBFGBCD-QKDMMWSPSA-N |
| SMILES | CO[C@H]1[C@@H](O[C@H](CO1)[C@@H](CO)O)OC2=CC3=C(C(=C2)OC)[C@@]4([C@@H]([C@@H]([C@H]([C@@]4(O3)C5=CC=C(C=C5)OC)C6=CC=CC=C6)C(=O)OC)O)O |
| Reference | <p style=/line-height:25px/> |
