For research use only. Not for therapeutic Use.
Episterol is a high-purity sterol essential for advanced pharmaceutical and biochemical research. This compound is vital for studies involving sterol metabolism, cell membrane biology, and cholesterol biosynthesis pathways. With its stability and well-defined structure, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
| Catalog Number | R021918 |
| CAS Number | 474-68-0 |
| Synonyms | 24-Methyl-5α-cholesta-7,24(28)-dien-3β-ol; 24-Methylene-5α-cholest-7-en-3β-ol; 24-Methylenecholesta-7,24(28)-dien-3β-ol; Episterin; Episterol; Δ7,24(28)-Ergostadienol |
| Molecular Formula | C28H46O |
| Purity | ≥95% |
| Storage | 2°C to 8°C |
| IUPAC Name | (3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | BTCAEOLDEYPGGE-JVAZTMFWSA-N |
| SMILES | CC(C)C(=C)CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C)C |
