For research use only. Not for therapeutic Use.
Epoxyazadiradione(Cat No.:M078841)is a naturally occurring triterpenoid compound derived from the neem tree (Azadirachta indica). It is a secondary metabolite with notable bioactive properties, primarily recognized for its role in insect growth regulation and anti-feedant activity. Epoxyazadiradione disrupts molting and reproduction in insects, making it an eco-friendly alternative in pest management. Additionally, it has shown potential in pharmaceutical research due to its antimicrobial and anti-inflammatory properties. This compound offers valuable insights into natural product chemistry and the development of sustainable agricultural and therapeutic solutions.
Catalog Number | M078841 |
CAS Number | 18385-59-6 |
Synonyms | epoxyazadiradione |
Molecular Formula | C28H34O6 |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | [(1S,2R,4S,6S,7S,10R,11R,16R,18R)-6-(furan-3-yl)-1,7,11,15,15-pentamethyl-5,14-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-12-en-18-yl] acetate |
InChI | InChI=1S/C28H34O6/c1-15(29)33-20-13-18-24(2,3)19(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)22(31)23-28(26,34-23)27(17,20)6/h8-10,12,14,17-18,20-21,23H,7,11,13H2,1-6H3/t17-,18+,20-,21-,23-,25-,26+,27+,28-/m1/s1 |
InChIKey | NEYCGDYQBQONFC-GGPFZBFUSA-N |
SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1([C@]45[C@H](O4)C(=O)[C@H]([C@@]5(CC3)C)C6=COC=C6)C)C |
Reference | <span style=”color:#000000;”><span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1.Shilpa, G., et al. "Epoxyazadiradione purified from the Azadirachta indica seed induced mitochondrial apoptosis and inhibition of NFκB nuclear translocation in human cervical cancer cells." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Phytotherapy Research</i> 31.12 (2017): 1892-1902.</span></span></span> |