For research use only. Not for therapeutic Use.
EPZ-015666 (CAT: I002063) is a small-molecule inhibitor that targets the protein arginine methyltransferase 5 (PRMT5). PRMT5 is an enzyme involved in the methylation of histone and non-histone proteins, which plays a crucial role in gene expression regulation. By inhibiting PRMT5, EPZ-015666 disrupts the methylation process and affects downstream cellular processes, including cell proliferation and differentiation. EPZ-015666 has shown promise as a potential therapeutic agent in various cancer types, where PRMT5 is often dysregulated and contributes to tumor growth and progression.
CAS Number | 1616391-65-1 |
Synonyms | EPZ-015666; (R)-N-(3-(3,4-dihydroisoquinolin-2(1H)-yl)-2-hydroxypropyl)-6-(oxetan-3-ylamino)pyrimidine-4-carboxamide |
Molecular Formula | C₂₀H₂₅N₅O₃ |
Purity | ≥95% |
Target | Histone Methyltransferase |
Solubility | DMSO: 60 mg/mL (warmed), H2O: < 1 mg/mL |
Storage | Store at -20°C |
IC50 | 5 nM (Ki) |
InChI | InChI=1S/C20H25N5O3/c26-17(10-25-6-5-14-3-1-2-4-15(14)9-25)8-21-20(27)18-7-19(23-13-22-18)24-16-11-28-12-16/h1-4,7,13,16-17,26H,5-6,8-12H2,(H,21,27)(H,22,23,24)/t17-/m0/s1 |
InChIKey | ZKXZLIFRWWKZRY-KRWDZBQOSA-N |
SMILES | C1CN(CC2=CC=CC=C21)CC(CNC(=O)C3=CC(=NC=N3)NC4COC4)O |
Reference | 1. Xenobiotica. 2016;46(3):268-77. <br><br> 1. Metabolite profiling and identification studies were conducted to understand 2. ACS Med Chem Lett. 2015 Dec 2;7(2):162-6. doi: 10.1021/acsmedchemlett.5b00380. <br><br> |