For research use only. Not for therapeutic Use.
ER-27319(CAT: I040950) is a potent and selective SYK (Spleen Tyrosine Kinase) inhibitor, acting by inhibiting the tyrosine phosphorylation and subsequent activity of SYK. As an acridone derivative, it demonstrates significant efficacy in modulating immune cell signaling. ER-27319 effectively inhibits the release of antigen-induced allergic mediators from human and rat mast cells with an IC50 of 10 μM. This makes it a valuable tool for research in Inflammation & Immunology Research, particularly in the study of allergic diseases and mast cell-related immune responses.
| CAS Number | 201010-95-9 |
| Synonyms | 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;oxalic acid |
| Molecular Formula | C20H22N2O5 |
| Purity | ≥95% |
| IUPAC Name | 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;oxalic acid |
| InChI | InChI=1S/C18H20N2O.C2H2O4/c1-12-8-9-15-17(13(12)2)20(11-5-10-19)16-7-4-3-6-14(16)18(15)21;3-1(4)2(5)6/h3-4,6-9H,5,10-11,19H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | IIELZHYJYZBSGG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3N2CCCN)C.C(=O)(C(=O)O)O |
